C32H46N4O5 — CID 15521928
ethyl (3S)-3-(2,3-dihydro-1-benzofuran-6-yl)-3-[3-[(2-methylpropan-2-yl)oxycarbonyl-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]amino]propylamino]propanoate (PubChem CID 15521928) has the molecular formula C32H46N4O5 and a molecular weight of 566.74 g/mol. Its IUPAC name is ethyl (3S)-3-(2,3-dihydro-1-benzofuran-6-yl)-3-[3-[(2-methylpropan-2-yl)oxycarbonyl-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]amino]propylamino]propanoate.
| Compound Name | ethyl (3S)-3-(2,3-dihydro-1-benzofuran-6-yl)-3-[3-[(2-methylpropan-2-yl)oxycarbonyl-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]amino]propylamino]propanoate |
|---|---|
| PubChem CID | 15521928 |
| Molecular Formula | C32H46N4O5 |
| Molecular Weight | 566.74 g/mol |
| Exact Mass | 566.35 |
| IUPAC Name | ethyl (3S)-3-(2,3-dihydro-1-benzofuran-6-yl)-3-[3-[(2-methylpropan-2-yl)oxycarbonyl-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]amino]propylamino]propanoate |
| SMILES | CCOC(=O)C[C@H](NCCCN(CCCc1ccc2c(n1)NCCC2)C(=O)OC(C)(C)C)c1ccc2c(c1)OCC2 |
| InChI | InChI=1S/C32H46N4O5/c1-5-39-29(37)22-27(25-12-11-23-15-20-40-28(23)21-25)33-17-8-19-36(31(38)41-32(2,3)4)18-7-10-26-14-13-24-9-6-16-34-30(24)35-26/h11-14,21,27,33H,5-10,15-20,22H2,1-4H3,(H,34,35)/t27-/m0/s1 |
| InChIKey | AYRCIPWBOIRKLB-MHZLTWQESA-N |
| XLogP | 5.22 |
| TPSA | 102.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.74 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|