C23H27N3O4S — CID 54355895
(3S)-3-(2,3-dihydro-1-benzofuran-6-yl)-3-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-ylmethylsulfanyl)propanoylamino]propanoic acid (PubChem CID 54355895) has the molecular formula C23H27N3O4S and a molecular weight of 441.55 g/mol. Its IUPAC name is (3S)-3-(2,3-dihydro-1-benzofuran-6-yl)-3-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-ylmethylsulfanyl)propanoylamino]propanoic acid.
| Compound Name | (3S)-3-(2,3-dihydro-1-benzofuran-6-yl)-3-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-ylmethylsulfanyl)propanoylamino]propanoic acid |
|---|---|
| PubChem CID | 54355895 |
| Molecular Formula | C23H27N3O4S |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | (3S)-3-(2,3-dihydro-1-benzofuran-6-yl)-3-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-ylmethylsulfanyl)propanoylamino]propanoic acid |
| SMILES | O=C(O)C[C@H](NC(=O)CCSCc1ccc2c(n1)NCCC2)c1ccc2c(c1)OCC2 |
| InChI | InChI=1S/C23H27N3O4S/c27-21(8-11-31-14-18-6-5-16-2-1-9-24-23(16)25-18)26-19(13-22(28)29)17-4-3-15-7-10-30-20(15)12-17/h3-6,12,19H,1-2,7-11,13-14H2,(H,24,25)(H,26,27)(H,28,29)/t19-/m0/s1 |
| InChIKey | JDEOMIPYTFIAHX-IBGZPJMESA-N |
| XLogP | 3.33 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|