C35H44N2O4SSi — CID 21059941
ethyl 4-[2-[4-[tert-butyl(diphenyl)silyl]oxybutyl]-1,3-thiazol-4-yl]-3-(6-methoxy-3-pyridinyl)butanoate (PubChem CID 21059941) has the molecular formula C35H44N2O4SSi and a molecular weight of 616.90 g/mol. Its IUPAC name is ethyl 4-[2-[4-[tert-butyl(diphenyl)silyl]oxybutyl]-1,3-thiazol-4-yl]-3-(6-methoxy-3-pyridinyl)butanoate.
| Compound Name | ethyl 4-[2-[4-[tert-butyl(diphenyl)silyl]oxybutyl]-1,3-thiazol-4-yl]-3-(6-methoxy-3-pyridinyl)butanoate |
|---|---|
| PubChem CID | 21059941 |
| Molecular Formula | C35H44N2O4SSi |
| Molecular Weight | 616.90 g/mol |
| Exact Mass | 616.28 |
| IUPAC Name | ethyl 4-[2-[4-[tert-butyl(diphenyl)silyl]oxybutyl]-1,3-thiazol-4-yl]-3-(6-methoxy-3-pyridinyl)butanoate |
| SMILES | CCOC(=O)CC(Cc1csc(CCCCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)n1)c1ccc(OC)nc1 |
| InChI | InChI=1S/C35H44N2O4SSi/c1-6-40-34(38)24-28(27-20-21-32(39-5)36-25-27)23-29-26-42-33(37-29)19-13-14-22-41-43(35(2,3)4,30-15-9-7-10-16-30)31-17-11-8-12-18-31/h7-12,15-18,20-21,25-26,28H,6,13-14,19,22-24H2,1-5H3 |
| InChIKey | WNZIYMUROGXGRU-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.90 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|