C23H31N3O3 — CID 25032675
acetic acid;N-[2-(4-butoxyphenyl)-1-phenylethyl]-4,5-dihydro-1H-imidazol-2-amine (PubChem CID 25032675) has the molecular formula C23H31N3O3 and a molecular weight of 397.52 g/mol. Its IUPAC name is acetic acid;N-[2-(4-butoxyphenyl)-1-phenylethyl]-4,5-dihydro-1H-imidazol-2-amine.
| Compound Name | acetic acid;N-[2-(4-butoxyphenyl)-1-phenylethyl]-4,5-dihydro-1H-imidazol-2-amine |
|---|---|
| PubChem CID | 25032675 |
| Molecular Formula | C23H31N3O3 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | acetic acid;N-[2-(4-butoxyphenyl)-1-phenylethyl]-4,5-dihydro-1H-imidazol-2-amine |
| SMILES | CC(=O)O.CCCCOc1ccc(CC(NC2=NCCN2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H27N3O.C2H4O2/c1-2-3-15-25-19-11-9-17(10-12-19)16-20(18-7-5-4-6-8-18)24-21-22-13-14-23-21;1-2(3)4/h4-12,20H,2-3,13-16H2,1H3,(H2,22,23,24);1H3,(H,3,4) |
| InChIKey | JFLUZDPLFIYVNZ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|