C18H20FN3O2 — CID 25032490
N-[2-(3-fluorophenyl)-1-phenylethyl]-4,5-dihydro-1H-imidazol-2-amine;formic acid (PubChem CID 25032490) has the molecular formula C18H20FN3O2 and a molecular weight of 329.38 g/mol. Its IUPAC name is N-[2-(3-fluorophenyl)-1-phenylethyl]-4,5-dihydro-1H-imidazol-2-amine;formic acid.
| Compound Name | N-[2-(3-fluorophenyl)-1-phenylethyl]-4,5-dihydro-1H-imidazol-2-amine;formic acid |
|---|---|
| PubChem CID | 25032490 |
| Molecular Formula | C18H20FN3O2 |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | N-[2-(3-fluorophenyl)-1-phenylethyl]-4,5-dihydro-1H-imidazol-2-amine;formic acid |
| SMILES | Fc1cccc(CC(NC2=NCCN2)c2ccccc2)c1.O=CO |
| InChI | InChI=1S/C17H18FN3.CH2O2/c18-15-8-4-5-13(11-15)12-16(14-6-2-1-3-7-14)21-17-19-9-10-20-17;2-1-3/h1-8,11,16H,9-10,12H2,(H2,19,20,21);1H,(H,2,3) |
| InChIKey | FWNJUYPAOBEMHM-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|