methyl 2-(4,5-dihydro-1H-imidazol-2-ylamino)-2-phenylacetate

C12H15N3O2 — CID 114400162

IUPACmethyl 2-(4,5-dihydro-1H-imidazol-2-ylamino)-2-phenylacetate
SMILESCOC(=O)C(NC1=NCCN1)c1ccccc1
InChIInChI=1S/C12H15N3O2/c1-17-11(16)10(9-5-3-2-4-6-9)15-12-13-7-8-14-12/h2-6,10H,7-8H2,1H3,(H2,13,14,15)
InChIKeyGTGPUKFGAIZMRV-UHFFFAOYSA-N
MW233.27 g/mol
LogP0.45
Rot. Bonds3

About methyl 2-(4,5-dihydro-1H-imidazol-2-ylamino)-2-phenylacetate

methyl 2-(4,5-dihydro-1H-imidazol-2-ylamino)-2-phenylacetate (PubChem CID 114400162) has the molecular formula C12H15N3O2 and a molecular weight of 233.27 g/mol. Its IUPAC name is methyl 2-(4,5-dihydro-1H-imidazol-2-ylamino)-2-phenylacetate.

Molecular Properties

Compound Namemethyl 2-(4,5-dihydro-1H-imidazol-2-ylamino)-2-phenylacetate
PubChem CID114400162
Molecular FormulaC12H15N3O2
Molecular Weight233.27 g/mol
Exact Mass233.12
IUPAC Namemethyl 2-(4,5-dihydro-1H-imidazol-2-ylamino)-2-phenylacetate
SMILESCOC(=O)C(NC1=NCCN1)c1ccccc1
InChIInChI=1S/C12H15N3O2/c1-17-11(16)10(9-5-3-2-4-6-9)15-12-13-7-8-14-12/h2-6,10H,7-8H2,1H3,(H2,13,14,15)
InChIKeyGTGPUKFGAIZMRV-UHFFFAOYSA-N
XLogP0.45
TPSA62.72 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500233.27
LogP ≤ 50.45
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze methyl 2-(4,5-dihydro-1H-imidazol-2-ylamino)-2-phenylacetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(4,5-dihydro-1H-imidazol-2-ylamino)-2-phenylacetate?
The IUPAC name of methyl 2-(4,5-dihydro-1H-imidazol-2-ylamino)-2-phenylacetate (CID 114400162) is methyl 2-(4,5-dihydro-1H-imidazol-2-ylamino)-2-phenylacetate.
What is the SMILES notation for methyl 2-(4,5-dihydro-1H-imidazol-2-ylamino)-2-phenylacetate?
The canonical SMILES for methyl 2-(4,5-dihydro-1H-imidazol-2-ylamino)-2-phenylacetate is COC(=O)C(NC1=NCCN1)c1ccccc1.
What is the InChIKey of methyl 2-(4,5-dihydro-1H-imidazol-2-ylamino)-2-phenylacetate?
The InChIKey is GTGPUKFGAIZMRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O2/c1-17-11(16)10(9-5-3-2-4-6-9)15-12-13-7-8-14-12/h2-6,10H,7-8H2,1H3,(H2,13,14,15).
What are the key properties of methyl 2-(4,5-dihydro-1H-imidazol-2-ylamino)-2-phenylacetate?
methyl 2-(4,5-dihydro-1H-imidazol-2-ylamino)-2-phenylacetate has a molecular weight of 233.27 g/mol, XLogP of 0.45, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(4,5-dihydro-1H-imidazol-2-ylamino)-2-phenylacetate is sourced from PubChem (CID 114400162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).