C24H26N4O3 — CID 22714539
3-[6-[3-(1H-imidazol-2-ylamino)propoxy]-1H-indol-3-yl]-3-(2-methylphenyl)propanoic acid (PubChem CID 22714539) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is 3-[6-[3-(1H-imidazol-2-ylamino)propoxy]-1H-indol-3-yl]-3-(2-methylphenyl)propanoic acid.
| Compound Name | 3-[6-[3-(1H-imidazol-2-ylamino)propoxy]-1H-indol-3-yl]-3-(2-methylphenyl)propanoic acid |
|---|---|
| PubChem CID | 22714539 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 3-[6-[3-(1H-imidazol-2-ylamino)propoxy]-1H-indol-3-yl]-3-(2-methylphenyl)propanoic acid |
| SMILES | Cc1ccccc1C(CC(=O)O)c1c[nH]c2cc(OCCCNc3ncc[nH]3)ccc12 |
| InChI | InChI=1S/C24H26N4O3/c1-16-5-2-3-6-18(16)20(14-23(29)30)21-15-28-22-13-17(7-8-19(21)22)31-12-4-9-25-24-26-10-11-27-24/h2-3,5-8,10-11,13,15,20,28H,4,9,12,14H2,1H3,(H,29,30)(H2,25,26,27) |
| InChIKey | HORPLQIQPFPIJD-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 103.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|