C18H23N3O3 — CID 122522413
(3S)-3-amino-4-[4-[3-(pyridin-2-ylamino)propoxy]phenyl]butanoic acid (PubChem CID 122522413) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is (3S)-3-amino-4-[4-[3-(pyridin-2-ylamino)propoxy]phenyl]butanoic acid.
| Compound Name | (3S)-3-amino-4-[4-[3-(pyridin-2-ylamino)propoxy]phenyl]butanoic acid |
|---|---|
| PubChem CID | 122522413 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | (3S)-3-amino-4-[4-[3-(pyridin-2-ylamino)propoxy]phenyl]butanoic acid |
| SMILES | N[C@H](CC(=O)O)Cc1ccc(OCCCNc2ccccn2)cc1 |
| InChI | InChI=1S/C18H23N3O3/c19-15(13-18(22)23)12-14-5-7-16(8-6-14)24-11-3-10-21-17-4-1-2-9-20-17/h1-2,4-9,15H,3,10-13,19H2,(H,20,21)(H,22,23)/t15-/m0/s1 |
| InChIKey | LHDKGGIWSFAYTK-HNNXBMFYSA-N |
| XLogP | 2.31 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|