C30H36Cl2N4O4 — CID 69244240
2-(diethylamino)ethyl (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[4-[3-(pyridin-2-ylamino)propoxy]phenyl]propanoate (PubChem CID 69244240) has the molecular formula C30H36Cl2N4O4 and a molecular weight of 587.55 g/mol. Its IUPAC name is 2-(diethylamino)ethyl (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[4-[3-(pyridin-2-ylamino)propoxy]phenyl]propanoate.
| Compound Name | 2-(diethylamino)ethyl (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[4-[3-(pyridin-2-ylamino)propoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 69244240 |
| Molecular Formula | C30H36Cl2N4O4 |
| Molecular Weight | 587.55 g/mol |
| Exact Mass | 586.21 |
| IUPAC Name | 2-(diethylamino)ethyl (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[4-[3-(pyridin-2-ylamino)propoxy]phenyl]propanoate |
| SMILES | CCN(CC)CCOC(=O)[C@H](Cc1ccc(OCCCNc2ccccn2)cc1)NC(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C30H36Cl2N4O4/c1-3-36(4-2)18-20-40-30(38)26(35-29(37)28-24(31)9-7-10-25(28)32)21-22-12-14-23(15-13-22)39-19-8-17-34-27-11-5-6-16-33-27/h5-7,9-16,26H,3-4,8,17-21H2,1-2H3,(H,33,34)(H,35,37)/t26-/m0/s1 |
| InChIKey | WRHTZFCRVAVSQW-SANMLTNESA-N |
| XLogP | 5.50 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.55 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|