C26H26Cl2N4O4 — CID 122532719
(2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[4-[methyl-[4-(pyridin-2-ylamino)butanoyl]amino]phenyl]propanoic acid (PubChem CID 122532719) has the molecular formula C26H26Cl2N4O4 and a molecular weight of 529.42 g/mol. Its IUPAC name is (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[4-[methyl-[4-(pyridin-2-ylamino)butanoyl]amino]phenyl]propanoic acid.
| Compound Name | (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[4-[methyl-[4-(pyridin-2-ylamino)butanoyl]amino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 122532719 |
| Molecular Formula | C26H26Cl2N4O4 |
| Molecular Weight | 529.42 g/mol |
| Exact Mass | 528.13 |
| IUPAC Name | (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[4-[methyl-[4-(pyridin-2-ylamino)butanoyl]amino]phenyl]propanoic acid |
| SMILES | CN(C(=O)CCCNc1ccccn1)c1ccc(C[C@H](NC(=O)c2c(Cl)cccc2Cl)C(=O)O)cc1 |
| InChI | InChI=1S/C26H26Cl2N4O4/c1-32(23(33)9-5-15-30-22-8-2-3-14-29-22)18-12-10-17(11-13-18)16-21(26(35)36)31-25(34)24-19(27)6-4-7-20(24)28/h2-4,6-8,10-14,21H,5,9,15-16H2,1H3,(H,29,30)(H,31,34)(H,35,36)/t21-/m0/s1 |
| InChIKey | YVTSAGWVTQOICP-NRFANRHFSA-N |
| XLogP | 4.67 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.42 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|