C28H31N3O6 — CID 146685219
(2S)-2-[(2,6-dimethoxybenzoyl)amino]-3-[4-[2-oxo-5-(pyridin-2-ylamino)pentyl]phenyl]propanoic acid (PubChem CID 146685219) has the molecular formula C28H31N3O6 and a molecular weight of 505.57 g/mol. Its IUPAC name is (2S)-2-[(2,6-dimethoxybenzoyl)amino]-3-[4-[2-oxo-5-(pyridin-2-ylamino)pentyl]phenyl]propanoic acid.
| Compound Name | (2S)-2-[(2,6-dimethoxybenzoyl)amino]-3-[4-[2-oxo-5-(pyridin-2-ylamino)pentyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 146685219 |
| Molecular Formula | C28H31N3O6 |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.22 |
| IUPAC Name | (2S)-2-[(2,6-dimethoxybenzoyl)amino]-3-[4-[2-oxo-5-(pyridin-2-ylamino)pentyl]phenyl]propanoic acid |
| SMILES | COc1cccc(OC)c1C(=O)N[C@@H](Cc1ccc(CC(=O)CCCNc2ccccn2)cc1)C(=O)O |
| InChI | InChI=1S/C28H31N3O6/c1-36-23-8-5-9-24(37-2)26(23)27(33)31-22(28(34)35)18-20-13-11-19(12-14-20)17-21(32)7-6-16-30-25-10-3-4-15-29-25/h3-5,8-15,22H,6-7,16-18H2,1-2H3,(H,29,30)(H,31,33)(H,34,35)/t22-/m0/s1 |
| InChIKey | PMUALVDUFXXOGO-QFIPXVFZSA-N |
| XLogP | 3.53 |
| TPSA | 126.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|