C25H24ClFN4O4 — CID 122533287
(2S)-2-[(2-chloro-6-fluorobenzoyl)amino]-3-[4-[4-(pyridin-2-ylamino)butanoylamino]phenyl]propanoic acid (PubChem CID 122533287) has the molecular formula C25H24ClFN4O4 and a molecular weight of 498.94 g/mol. Its IUPAC name is (2S)-2-[(2-chloro-6-fluorobenzoyl)amino]-3-[4-[4-(pyridin-2-ylamino)butanoylamino]phenyl]propanoic acid.
| Compound Name | (2S)-2-[(2-chloro-6-fluorobenzoyl)amino]-3-[4-[4-(pyridin-2-ylamino)butanoylamino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 122533287 |
| Molecular Formula | C25H24ClFN4O4 |
| Molecular Weight | 498.94 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | (2S)-2-[(2-chloro-6-fluorobenzoyl)amino]-3-[4-[4-(pyridin-2-ylamino)butanoylamino]phenyl]propanoic acid |
| SMILES | O=C(CCCNc1ccccn1)Nc1ccc(C[C@H](NC(=O)c2c(F)cccc2Cl)C(=O)O)cc1 |
| InChI | InChI=1S/C25H24ClFN4O4/c26-18-5-3-6-19(27)23(18)24(33)31-20(25(34)35)15-16-9-11-17(12-10-16)30-22(32)8-4-14-29-21-7-1-2-13-28-21/h1-3,5-7,9-13,20H,4,8,14-15H2,(H,28,29)(H,30,32)(H,31,33)(H,34,35)/t20-/m0/s1 |
| InChIKey | YIXUPWDGHLZLOS-FQEVSTJZSA-N |
| XLogP | 4.13 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.94 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|