C29H28N4O4 — CID 122533174
(2S)-2-(naphthalene-1-carbonylamino)-3-[4-[4-(pyridin-2-ylamino)butanoylamino]phenyl]propanoic acid (PubChem CID 122533174) has the molecular formula C29H28N4O4 and a molecular weight of 496.57 g/mol. Its IUPAC name is (2S)-2-(naphthalene-1-carbonylamino)-3-[4-[4-(pyridin-2-ylamino)butanoylamino]phenyl]propanoic acid.
| Compound Name | (2S)-2-(naphthalene-1-carbonylamino)-3-[4-[4-(pyridin-2-ylamino)butanoylamino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 122533174 |
| Molecular Formula | C29H28N4O4 |
| Molecular Weight | 496.57 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | (2S)-2-(naphthalene-1-carbonylamino)-3-[4-[4-(pyridin-2-ylamino)butanoylamino]phenyl]propanoic acid |
| SMILES | O=C(CCCNc1ccccn1)Nc1ccc(C[C@H](NC(=O)c2cccc3ccccc23)C(=O)O)cc1 |
| InChI | InChI=1S/C29H28N4O4/c34-27(12-6-18-31-26-11-3-4-17-30-26)32-22-15-13-20(14-16-22)19-25(29(36)37)33-28(35)24-10-5-8-21-7-1-2-9-23(21)24/h1-5,7-11,13-17,25H,6,12,18-19H2,(H,30,31)(H,32,34)(H,33,35)(H,36,37)/t25-/m0/s1 |
| InChIKey | YXNSEYPJLLIBMY-VWLOTQADSA-N |
| XLogP | 4.49 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.57 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|