C23H25ClN4O4 — CID 145154147
(2S)-2-[(2-chloro-6-methylbenzoyl)amino]-3-[5-[4-(pyridin-2-ylamino)butyl]-1,3-oxazol-2-yl]propanoic acid (PubChem CID 145154147) has the molecular formula C23H25ClN4O4 and a molecular weight of 456.93 g/mol. Its IUPAC name is (2S)-2-[(2-chloro-6-methylbenzoyl)amino]-3-[5-[4-(pyridin-2-ylamino)butyl]-1,3-oxazol-2-yl]propanoic acid.
| Compound Name | (2S)-2-[(2-chloro-6-methylbenzoyl)amino]-3-[5-[4-(pyridin-2-ylamino)butyl]-1,3-oxazol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 145154147 |
| Molecular Formula | C23H25ClN4O4 |
| Molecular Weight | 456.93 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | (2S)-2-[(2-chloro-6-methylbenzoyl)amino]-3-[5-[4-(pyridin-2-ylamino)butyl]-1,3-oxazol-2-yl]propanoic acid |
| SMILES | Cc1cccc(Cl)c1C(=O)N[C@@H](Cc1ncc(CCCCNc2ccccn2)o1)C(=O)O |
| InChI | InChI=1S/C23H25ClN4O4/c1-15-7-6-9-17(24)21(15)22(29)28-18(23(30)31)13-20-27-14-16(32-20)8-2-4-11-25-19-10-3-5-12-26-19/h3,5-7,9-10,12,14,18H,2,4,8,11,13H2,1H3,(H,25,26)(H,28,29)(H,30,31)/t18-/m0/s1 |
| InChIKey | BZVACCCWSKYMMI-SFHVURJKSA-N |
| XLogP | 3.89 |
| TPSA | 117.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.93 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|