C24H23Cl2N3O4 — CID 42632602
methyl (2R)-2-[(2,6-dichlorobenzoyl)amino]-3-[4-[2-(pyridin-2-ylamino)ethoxy]phenyl]propanoate (PubChem CID 42632602) has the molecular formula C24H23Cl2N3O4 and a molecular weight of 488.37 g/mol. Its IUPAC name is methyl (2R)-2-[(2,6-dichlorobenzoyl)amino]-3-[4-[2-(pyridin-2-ylamino)ethoxy]phenyl]propanoate.
| Compound Name | methyl (2R)-2-[(2,6-dichlorobenzoyl)amino]-3-[4-[2-(pyridin-2-ylamino)ethoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 42632602 |
| Molecular Formula | C24H23Cl2N3O4 |
| Molecular Weight | 488.37 g/mol |
| Exact Mass | 487.11 |
| IUPAC Name | methyl (2R)-2-[(2,6-dichlorobenzoyl)amino]-3-[4-[2-(pyridin-2-ylamino)ethoxy]phenyl]propanoate |
| SMILES | COC(=O)[C@@H](Cc1ccc(OCCNc2ccccn2)cc1)NC(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C24H23Cl2N3O4/c1-32-24(31)20(29-23(30)22-18(25)5-4-6-19(22)26)15-16-8-10-17(11-9-16)33-14-13-28-21-7-2-3-12-27-21/h2-12,20H,13-15H2,1H3,(H,27,28)(H,29,30)/t20-/m1/s1 |
| InChIKey | SDHBWRLDKKYORO-HXUWFJFHSA-N |
| XLogP | 4.39 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.37 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|