C25H28Cl2N4O5 — CID 134394456
methyl (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[4-[4-[(1-methyl-5-oxo-4H-imidazol-2-yl)amino]butoxy]phenyl]propanoate (PubChem CID 134394456) has the molecular formula C25H28Cl2N4O5 and a molecular weight of 535.43 g/mol. Its IUPAC name is methyl (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[4-[4-[(1-methyl-5-oxo-4H-imidazol-2-yl)amino]butoxy]phenyl]propanoate.
| Compound Name | methyl (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[4-[4-[(1-methyl-5-oxo-4H-imidazol-2-yl)amino]butoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 134394456 |
| Molecular Formula | C25H28Cl2N4O5 |
| Molecular Weight | 535.43 g/mol |
| Exact Mass | 534.14 |
| IUPAC Name | methyl (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[4-[4-[(1-methyl-5-oxo-4H-imidazol-2-yl)amino]butoxy]phenyl]propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(OCCCCNC2=NCC(=O)N2C)cc1)NC(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C25H28Cl2N4O5/c1-31-21(32)15-29-25(31)28-12-3-4-13-36-17-10-8-16(9-11-17)14-20(24(34)35-2)30-23(33)22-18(26)6-5-7-19(22)27/h5-11,20H,3-4,12-15H2,1-2H3,(H,28,29)(H,30,33)/t20-/m0/s1 |
| InChIKey | IVURORJKRUBSEP-FQEVSTJZSA-N |
| XLogP | 3.08 |
| TPSA | 109.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.43 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|