C22H30Cl2N4O4 — CID 146451850
(2R)-2-[(2,6-dichlorobenzoyl)amino]-10-[(1-methyl-6-oxo-2,5-dihydropyrazin-3-yl)amino]decanoic acid (PubChem CID 146451850) has the molecular formula C22H30Cl2N4O4 and a molecular weight of 485.41 g/mol. Its IUPAC name is (2R)-2-[(2,6-dichlorobenzoyl)amino]-10-[(1-methyl-6-oxo-2,5-dihydropyrazin-3-yl)amino]decanoic acid.
| Compound Name | (2R)-2-[(2,6-dichlorobenzoyl)amino]-10-[(1-methyl-6-oxo-2,5-dihydropyrazin-3-yl)amino]decanoic acid |
|---|---|
| PubChem CID | 146451850 |
| Molecular Formula | C22H30Cl2N4O4 |
| Molecular Weight | 485.41 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | (2R)-2-[(2,6-dichlorobenzoyl)amino]-10-[(1-methyl-6-oxo-2,5-dihydropyrazin-3-yl)amino]decanoic acid |
| SMILES | CN1CC(NCCCCCCCC[C@@H](NC(=O)c2c(Cl)cccc2Cl)C(=O)O)=NCC1=O |
| InChI | InChI=1S/C22H30Cl2N4O4/c1-28-14-18(26-13-19(28)29)25-12-7-5-3-2-4-6-11-17(22(31)32)27-21(30)20-15(23)9-8-10-16(20)24/h8-10,17H,2-7,11-14H2,1H3,(H,25,26)(H,27,30)(H,31,32)/t17-/m1/s1 |
| InChIKey | UNKFNNRIFVNGCT-QGZVFWFLSA-N |
| XLogP | 3.37 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.41 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|