C25H28Cl2N4O5 — CID 134394654
2-[(2,6-dichlorobenzoyl)amino]-3-[4-[4-[(1-methyl-6-oxo-2,3-dihydropyrazin-5-yl)amino]butoxy]phenyl]propanoic acid (PubChem CID 134394654) has the molecular formula C25H28Cl2N4O5 and a molecular weight of 535.43 g/mol. Its IUPAC name is 2-[(2,6-dichlorobenzoyl)amino]-3-[4-[4-[(1-methyl-6-oxo-2,3-dihydropyrazin-5-yl)amino]butoxy]phenyl]propanoic acid.
| Compound Name | 2-[(2,6-dichlorobenzoyl)amino]-3-[4-[4-[(1-methyl-6-oxo-2,3-dihydropyrazin-5-yl)amino]butoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 134394654 |
| Molecular Formula | C25H28Cl2N4O5 |
| Molecular Weight | 535.43 g/mol |
| Exact Mass | 534.14 |
| IUPAC Name | 2-[(2,6-dichlorobenzoyl)amino]-3-[4-[4-[(1-methyl-6-oxo-2,3-dihydropyrazin-5-yl)amino]butoxy]phenyl]propanoic acid |
| SMILES | CN1CCN=C(NCCCCOc2ccc(CC(NC(=O)c3c(Cl)cccc3Cl)C(=O)O)cc2)C1=O |
| InChI | InChI=1S/C25H28Cl2N4O5/c1-31-13-12-29-22(24(31)33)28-11-2-3-14-36-17-9-7-16(8-10-17)15-20(25(34)35)30-23(32)21-18(26)5-4-6-19(21)27/h4-10,20H,2-3,11-15H2,1H3,(H,28,29)(H,30,32)(H,34,35) |
| InChIKey | ORSONDXMTHSCHR-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 120.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.43 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|