C27H26Cl2N2O4 — CID 149116436
2-[(2,6-dichlorobenzoyl)amino]-3-[4-[3-(6,7-dihydro-5H-cyclopenta[b]pyridin-6-yl)propoxy]phenyl]propanoic acid (PubChem CID 149116436) has the molecular formula C27H26Cl2N2O4 and a molecular weight of 513.42 g/mol. Its IUPAC name is 2-[(2,6-dichlorobenzoyl)amino]-3-[4-[3-(6,7-dihydro-5H-cyclopenta[b]pyridin-6-yl)propoxy]phenyl]propanoic acid.
| Compound Name | 2-[(2,6-dichlorobenzoyl)amino]-3-[4-[3-(6,7-dihydro-5H-cyclopenta[b]pyridin-6-yl)propoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 149116436 |
| Molecular Formula | C27H26Cl2N2O4 |
| Molecular Weight | 513.42 g/mol |
| Exact Mass | 512.13 |
| IUPAC Name | 2-[(2,6-dichlorobenzoyl)amino]-3-[4-[3-(6,7-dihydro-5H-cyclopenta[b]pyridin-6-yl)propoxy]phenyl]propanoic acid |
| SMILES | O=C(NC(Cc1ccc(OCCCC2Cc3cccnc3C2)cc1)C(=O)O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C27H26Cl2N2O4/c28-21-6-1-7-22(29)25(21)26(32)31-24(27(33)34)15-17-8-10-20(11-9-17)35-13-3-4-18-14-19-5-2-12-30-23(19)16-18/h1-2,5-12,18,24H,3-4,13-16H2,(H,31,32)(H,33,34) |
| InChIKey | QYLUDKDFQSZFCX-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.42 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|