C26H27Cl2N3O5 — CID 59665311
(2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[4-[2-[6-(2-methoxyethylamino)-2-pyridinyl]ethoxy]phenyl]propanoic acid (PubChem CID 59665311) has the molecular formula C26H27Cl2N3O5 and a molecular weight of 532.42 g/mol. Its IUPAC name is (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[4-[2-[6-(2-methoxyethylamino)-2-pyridinyl]ethoxy]phenyl]propanoic acid.
| Compound Name | (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[4-[2-[6-(2-methoxyethylamino)-2-pyridinyl]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 59665311 |
| Molecular Formula | C26H27Cl2N3O5 |
| Molecular Weight | 532.42 g/mol |
| Exact Mass | 531.13 |
| IUPAC Name | (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[4-[2-[6-(2-methoxyethylamino)-2-pyridinyl]ethoxy]phenyl]propanoic acid |
| SMILES | COCCNc1cccc(CCOc2ccc(C[C@H](NC(=O)c3c(Cl)cccc3Cl)C(=O)O)cc2)n1 |
| InChI | InChI=1S/C26H27Cl2N3O5/c1-35-15-13-29-23-7-2-4-18(30-23)12-14-36-19-10-8-17(9-11-19)16-22(26(33)34)31-25(32)24-20(27)5-3-6-21(24)28/h2-11,22H,12-16H2,1H3,(H,29,30)(H,31,32)(H,33,34)/t22-/m0/s1 |
| InChIKey | RMYIXOZHZBHMFD-QFIPXVFZSA-N |
| XLogP | 4.49 |
| TPSA | 109.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.42 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|