C26H24Cl2N4O4 — CID 59665468
methyl (2S)-3-[4-[2-(1H-benzimidazol-2-ylamino)ethoxy]phenyl]-2-[(2,6-dichlorobenzoyl)amino]propanoate (PubChem CID 59665468) has the molecular formula C26H24Cl2N4O4 and a molecular weight of 527.41 g/mol. Its IUPAC name is methyl (2S)-3-[4-[2-(1H-benzimidazol-2-ylamino)ethoxy]phenyl]-2-[(2,6-dichlorobenzoyl)amino]propanoate.
| Compound Name | methyl (2S)-3-[4-[2-(1H-benzimidazol-2-ylamino)ethoxy]phenyl]-2-[(2,6-dichlorobenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 59665468 |
| Molecular Formula | C26H24Cl2N4O4 |
| Molecular Weight | 527.41 g/mol |
| Exact Mass | 526.12 |
| IUPAC Name | methyl (2S)-3-[4-[2-(1H-benzimidazol-2-ylamino)ethoxy]phenyl]-2-[(2,6-dichlorobenzoyl)amino]propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(OCCNc2nc3ccccc3[nH]2)cc1)NC(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C26H24Cl2N4O4/c1-35-25(34)22(30-24(33)23-18(27)5-4-6-19(23)28)15-16-9-11-17(12-10-16)36-14-13-29-26-31-20-7-2-3-8-21(20)32-26/h2-12,22H,13-15H2,1H3,(H,30,33)(H2,29,31,32)/t22-/m0/s1 |
| InChIKey | WLZCLFWHVFDJDL-QFIPXVFZSA-N |
| XLogP | 4.87 |
| TPSA | 105.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.41 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|