C26H27Cl2N3O4 — CID 68900930
methyl (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[4-[3-[(5-methyl-2-pyridinyl)amino]propoxy]phenyl]propanoate (PubChem CID 68900930) has the molecular formula C26H27Cl2N3O4 and a molecular weight of 516.43 g/mol. Its IUPAC name is methyl (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[4-[3-[(5-methyl-2-pyridinyl)amino]propoxy]phenyl]propanoate.
| Compound Name | methyl (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[4-[3-[(5-methyl-2-pyridinyl)amino]propoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 68900930 |
| Molecular Formula | C26H27Cl2N3O4 |
| Molecular Weight | 516.43 g/mol |
| Exact Mass | 515.14 |
| IUPAC Name | methyl (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[4-[3-[(5-methyl-2-pyridinyl)amino]propoxy]phenyl]propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(OCCCNc2ccc(C)cn2)cc1)NC(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C26H27Cl2N3O4/c1-17-7-12-23(30-16-17)29-13-4-14-35-19-10-8-18(9-11-19)15-22(26(33)34-2)31-25(32)24-20(27)5-3-6-21(24)28/h3,5-12,16,22H,4,13-15H2,1-2H3,(H,29,30)(H,31,32)/t22-/m0/s1 |
| InChIKey | WKIVONSMXKHROP-QFIPXVFZSA-N |
| XLogP | 5.09 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.43 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|