C20H20Cl2N6O3 — CID 122532708
(2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[4-[3-(pyridin-2-ylamino)propyl]triazol-1-yl]propanoic acid (PubChem CID 122532708) has the molecular formula C20H20Cl2N6O3 and a molecular weight of 463.33 g/mol. Its IUPAC name is (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[4-[3-(pyridin-2-ylamino)propyl]triazol-1-yl]propanoic acid.
| Compound Name | (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[4-[3-(pyridin-2-ylamino)propyl]triazol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 122532708 |
| Molecular Formula | C20H20Cl2N6O3 |
| Molecular Weight | 463.33 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[4-[3-(pyridin-2-ylamino)propyl]triazol-1-yl]propanoic acid |
| SMILES | O=C(N[C@@H](Cn1cc(CCCNc2ccccn2)nn1)C(=O)O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C20H20Cl2N6O3/c21-14-6-3-7-15(22)18(14)19(29)25-16(20(30)31)12-28-11-13(26-27-28)5-4-10-24-17-8-1-2-9-23-17/h1-3,6-9,11,16H,4-5,10,12H2,(H,23,24)(H,25,29)(H,30,31)/t16-/m0/s1 |
| InChIKey | RTWKNCCZRHCGSL-INIZCTEOSA-N |
| XLogP | 2.91 |
| TPSA | 122.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.33 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|