C22H29Cl2N3O4 — CID 162266110
(2S)-2-[(2,6-dichlorobenzoyl)amino]-11-(1-methyl-5-oxo-4H-imidazol-2-yl)undecanoic acid (PubChem CID 162266110) has the molecular formula C22H29Cl2N3O4 and a molecular weight of 470.40 g/mol. Its IUPAC name is (2S)-2-[(2,6-dichlorobenzoyl)amino]-11-(1-methyl-5-oxo-4H-imidazol-2-yl)undecanoic acid.
| Compound Name | (2S)-2-[(2,6-dichlorobenzoyl)amino]-11-(1-methyl-5-oxo-4H-imidazol-2-yl)undecanoic acid |
|---|---|
| PubChem CID | 162266110 |
| Molecular Formula | C22H29Cl2N3O4 |
| Molecular Weight | 470.40 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | (2S)-2-[(2,6-dichlorobenzoyl)amino]-11-(1-methyl-5-oxo-4H-imidazol-2-yl)undecanoic acid |
| SMILES | CN1C(=O)CN=C1CCCCCCCCC[C@H](NC(=O)c1c(Cl)cccc1Cl)C(=O)O |
| InChI | InChI=1S/C22H29Cl2N3O4/c1-27-18(25-14-19(27)28)13-8-6-4-2-3-5-7-12-17(22(30)31)26-21(29)20-15(23)10-9-11-16(20)24/h9-11,17H,2-8,12-14H2,1H3,(H,26,29)(H,30,31)/t17-/m0/s1 |
| InChIKey | OFUQNQAIMGYYCH-KRWDZBQOSA-N |
| XLogP | 4.56 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.40 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|