C16H17Cl2N5O3 — CID 59640704
(2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[[(isocyanoamino)-pyrrolidin-1-ylmethylidene]amino]propanoic acid (PubChem CID 59640704) has the molecular formula C16H17Cl2N5O3 and a molecular weight of 398.25 g/mol. Its IUPAC name is (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[[(isocyanoamino)-pyrrolidin-1-ylmethylidene]amino]propanoic acid.
| Compound Name | (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[[(isocyanoamino)-pyrrolidin-1-ylmethylidene]amino]propanoic acid |
|---|---|
| PubChem CID | 59640704 |
| Molecular Formula | C16H17Cl2N5O3 |
| Molecular Weight | 398.25 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[[(isocyanoamino)-pyrrolidin-1-ylmethylidene]amino]propanoic acid |
| SMILES | [C-]#[N+]N/C(=N\C[C@H](NC(=O)c1c(Cl)cccc1Cl)C(=O)O)N1CCCC1 |
| InChI | InChI=1S/C16H17Cl2N5O3/c1-19-22-16(23-7-2-3-8-23)20-9-12(15(25)26)21-14(24)13-10(17)5-4-6-11(13)18/h4-6,12H,2-3,7-9H2,(H,20,22)(H,21,24)(H,25,26)/t12-/m0/s1 |
| InChIKey | AXMIMKHUZVSXFX-LBPRGKRZSA-N |
| XLogP | 2.05 |
| TPSA | 98.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.25 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|