C25H27Cl2N5O5 — CID 11965430
(2S)-3-[[(cyanoamino)-pyrrolidin-1-ylmethylidene]amino]-2-[[2,6-dichloro-4-[3-hydroxy-3-(3-hydroxyphenyl)propyl]benzoyl]amino]propanoic acid (PubChem CID 11965430) has the molecular formula C25H27Cl2N5O5 and a molecular weight of 548.43 g/mol. Its IUPAC name is (2S)-3-[[(cyanoamino)-pyrrolidin-1-ylmethylidene]amino]-2-[[2,6-dichloro-4-[3-hydroxy-3-(3-hydroxyphenyl)propyl]benzoyl]amino]propanoic acid.
| Compound Name | (2S)-3-[[(cyanoamino)-pyrrolidin-1-ylmethylidene]amino]-2-[[2,6-dichloro-4-[3-hydroxy-3-(3-hydroxyphenyl)propyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 11965430 |
| Molecular Formula | C25H27Cl2N5O5 |
| Molecular Weight | 548.43 g/mol |
| Exact Mass | 547.14 |
| IUPAC Name | (2S)-3-[[(cyanoamino)-pyrrolidin-1-ylmethylidene]amino]-2-[[2,6-dichloro-4-[3-hydroxy-3-(3-hydroxyphenyl)propyl]benzoyl]amino]propanoic acid |
| SMILES | N#CN/C(=N\C[C@H](NC(=O)c1c(Cl)cc(CCC(O)c2cccc(O)c2)cc1Cl)C(=O)O)N1CCCC1 |
| InChI | InChI=1S/C25H27Cl2N5O5/c26-18-10-15(6-7-21(34)16-4-3-5-17(33)12-16)11-19(27)22(18)23(35)31-20(24(36)37)13-29-25(30-14-28)32-8-1-2-9-32/h3-5,10-12,20-21,33-34H,1-2,6-9,13H2,(H,29,30)(H,31,35)(H,36,37)/t20-,21?/m0/s1 |
| InChIKey | WJIHYMWGFFVBFB-BGERDNNASA-N |
| XLogP | 3.07 |
| TPSA | 158.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.43 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|