C24H27Cl2N5O6 — CID 73155332
3-[[(cyanoamino)-(2-methoxyethylamino)methylidene]amino]-2-[[2,6-dichloro-4-[3-hydroxy-3-(3-hydroxyphenyl)propyl]benzoyl]amino]propanoic acid (PubChem CID 73155332) has the molecular formula C24H27Cl2N5O6 and a molecular weight of 552.42 g/mol. Its IUPAC name is 3-[[(cyanoamino)-(2-methoxyethylamino)methylidene]amino]-2-[[2,6-dichloro-4-[3-hydroxy-3-(3-hydroxyphenyl)propyl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[(cyanoamino)-(2-methoxyethylamino)methylidene]amino]-2-[[2,6-dichloro-4-[3-hydroxy-3-(3-hydroxyphenyl)propyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 73155332 |
| Molecular Formula | C24H27Cl2N5O6 |
| Molecular Weight | 552.42 g/mol |
| Exact Mass | 551.13 |
| IUPAC Name | 3-[[(cyanoamino)-(2-methoxyethylamino)methylidene]amino]-2-[[2,6-dichloro-4-[3-hydroxy-3-(3-hydroxyphenyl)propyl]benzoyl]amino]propanoic acid |
| SMILES | COCCN/C(=N/CC(NC(=O)c1c(Cl)cc(CCC(O)c2cccc(O)c2)cc1Cl)C(=O)O)NC#N |
| InChI | InChI=1S/C24H27Cl2N5O6/c1-37-8-7-28-24(30-13-27)29-12-19(23(35)36)31-22(34)21-17(25)9-14(10-18(21)26)5-6-20(33)15-3-2-4-16(32)11-15/h2-4,9-11,19-20,32-33H,5-8,12H2,1H3,(H,31,34)(H,35,36)(H2,28,29,30) |
| InChIKey | RDHUEQLTCNTUHE-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 176.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.42 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|