C22H26Cl2FN5O5 — CID 88568096
(2S)-2-[[2,6-dichloro-4-[3-hydroxy-3-(3-hydroxyphenyl)propyl]benzoyl]amino]-3-[[(2-fluoroethylamino)-hydrazinylmethylidene]amino]propanoic acid (PubChem CID 88568096) has the molecular formula C22H26Cl2FN5O5 and a molecular weight of 530.38 g/mol. Its IUPAC name is (2S)-2-[[2,6-dichloro-4-[3-hydroxy-3-(3-hydroxyphenyl)propyl]benzoyl]amino]-3-[[(2-fluoroethylamino)-hydrazinylmethylidene]amino]propanoic acid.
| Compound Name | (2S)-2-[[2,6-dichloro-4-[3-hydroxy-3-(3-hydroxyphenyl)propyl]benzoyl]amino]-3-[[(2-fluoroethylamino)-hydrazinylmethylidene]amino]propanoic acid |
|---|---|
| PubChem CID | 88568096 |
| Molecular Formula | C22H26Cl2FN5O5 |
| Molecular Weight | 530.38 g/mol |
| Exact Mass | 529.13 |
| IUPAC Name | (2S)-2-[[2,6-dichloro-4-[3-hydroxy-3-(3-hydroxyphenyl)propyl]benzoyl]amino]-3-[[(2-fluoroethylamino)-hydrazinylmethylidene]amino]propanoic acid |
| SMILES | NN/C(=N/C[C@H](NC(=O)c1c(Cl)cc(CCC(O)c2cccc(O)c2)cc1Cl)C(=O)O)NCCF |
| InChI | InChI=1S/C22H26Cl2FN5O5/c23-15-8-12(4-5-18(32)13-2-1-3-14(31)10-13)9-16(24)19(15)20(33)29-17(21(34)35)11-28-22(30-26)27-7-6-25/h1-3,8-10,17-18,31-32H,4-7,11,26H2,(H,29,33)(H,34,35)(H2,27,28,30)/t17-,18?/m0/s1 |
| InChIKey | AFKBIYWOYZWIPG-ZENAZSQFSA-N |
| XLogP | 1.93 |
| TPSA | 169.30 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.38 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|