C29H28Cl2N6O4S — CID 122466591
(2S)-2-[[2-(1-benzothiophene-2-carbonyl)-5,7-dichloro-3,4-dihydro-1H-isoquinoline-6-carbonyl]amino]-3-[[(cyanoamino)-[(3S)-3-methylpyrrolidin-1-yl]methylidene]amino]propanoic acid (PubChem CID 122466591) has the molecular formula C29H28Cl2N6O4S and a molecular weight of 627.55 g/mol. Its IUPAC name is (2S)-2-[[2-(1-benzothiophene-2-carbonyl)-5,7-dichloro-3,4-dihydro-1H-isoquinoline-6-carbonyl]amino]-3-[[(cyanoamino)-[(3S)-3-methylpyrrolidin-1-yl]methylidene]amino]propanoic acid.
| Compound Name | (2S)-2-[[2-(1-benzothiophene-2-carbonyl)-5,7-dichloro-3,4-dihydro-1H-isoquinoline-6-carbonyl]amino]-3-[[(cyanoamino)-[(3S)-3-methylpyrrolidin-1-yl]methylidene]amino]propanoic acid |
|---|---|
| PubChem CID | 122466591 |
| Molecular Formula | C29H28Cl2N6O4S |
| Molecular Weight | 627.55 g/mol |
| Exact Mass | 626.13 |
| IUPAC Name | (2S)-2-[[2-(1-benzothiophene-2-carbonyl)-5,7-dichloro-3,4-dihydro-1H-isoquinoline-6-carbonyl]amino]-3-[[(cyanoamino)-[(3S)-3-methylpyrrolidin-1-yl]methylidene]amino]propanoic acid |
| SMILES | C[C@H]1CCN(/C(=N/C[C@H](NC(=O)c2c(Cl)cc3c(c2Cl)CCN(C(=O)c2cc4ccccc4s2)C3)C(=O)O)NC#N)C1 |
| InChI | InChI=1S/C29H28Cl2N6O4S/c1-16-6-8-37(13-16)29(34-15-32)33-12-21(28(40)41)35-26(38)24-20(30)10-18-14-36(9-7-19(18)25(24)31)27(39)23-11-17-4-2-3-5-22(17)42-23/h2-5,10-11,16,21H,6-9,12-14H2,1H3,(H,33,34)(H,35,38)(H,40,41)/t16-,21-/m0/s1 |
| InChIKey | ZPXLWVQCUXQNNL-KKSFZXQISA-N |
| XLogP | 4.36 |
| TPSA | 138.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.55 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|