C31H30Cl2N4O7 — CID 123709665
(2S)-2-[[2-(1-benzofuran-2-carbonyl)-5,7-dichloro-3,4-dihydro-1H-isoquinoline-6-carbonyl]amino]-3-[[2-cyano-1-[(3R,5S)-3,5-dihydroxycyclohexyl]ethylidene]amino]propanoic acid (PubChem CID 123709665) has the molecular formula C31H30Cl2N4O7 and a molecular weight of 641.51 g/mol. Its IUPAC name is (2S)-2-[[2-(1-benzofuran-2-carbonyl)-5,7-dichloro-3,4-dihydro-1H-isoquinoline-6-carbonyl]amino]-3-[[2-cyano-1-[(3R,5S)-3,5-dihydroxycyclohexyl]ethylidene]amino]propanoic acid.
| Compound Name | (2S)-2-[[2-(1-benzofuran-2-carbonyl)-5,7-dichloro-3,4-dihydro-1H-isoquinoline-6-carbonyl]amino]-3-[[2-cyano-1-[(3R,5S)-3,5-dihydroxycyclohexyl]ethylidene]amino]propanoic acid |
|---|---|
| PubChem CID | 123709665 |
| Molecular Formula | C31H30Cl2N4O7 |
| Molecular Weight | 641.51 g/mol |
| Exact Mass | 640.15 |
| IUPAC Name | (2S)-2-[[2-(1-benzofuran-2-carbonyl)-5,7-dichloro-3,4-dihydro-1H-isoquinoline-6-carbonyl]amino]-3-[[2-cyano-1-[(3R,5S)-3,5-dihydroxycyclohexyl]ethylidene]amino]propanoic acid |
| SMILES | N#CC/C(=N\C[C@H](NC(=O)c1c(Cl)cc2c(c1Cl)CCN(C(=O)c1cc3ccccc3o1)C2)C(=O)O)C1C[C@@H](O)C[C@@H](O)C1 |
| InChI | InChI=1S/C31H30Cl2N4O7/c32-22-11-18-15-37(30(41)26-12-16-3-1-2-4-25(16)44-26)8-6-21(18)28(33)27(22)29(40)36-24(31(42)43)14-35-23(5-7-34)17-9-19(38)13-20(39)10-17/h1-4,11-12,17,19-20,24,38-39H,5-6,8-10,13-15H2,(H,36,40)(H,42,43)/b35-23+/t17?,19-,20+,24-/m0/s1 |
| InChIKey | NPHLTPQBDNWMIL-RLOIYAPASA-N |
| XLogP | 4.00 |
| TPSA | 176.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.51 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|