C23H17Cl2FN2O3S — CID 12042605
(2S)-3-[4-[(2,6-dichlorobenzoyl)amino]phenyl]-2-[(2-fluorobenzenecarbothioyl)amino]propanoic acid (PubChem CID 12042605) has the molecular formula C23H17Cl2FN2O3S and a molecular weight of 491.37 g/mol. Its IUPAC name is (2S)-3-[4-[(2,6-dichlorobenzoyl)amino]phenyl]-2-[(2-fluorobenzenecarbothioyl)amino]propanoic acid.
| Compound Name | (2S)-3-[4-[(2,6-dichlorobenzoyl)amino]phenyl]-2-[(2-fluorobenzenecarbothioyl)amino]propanoic acid |
|---|---|
| PubChem CID | 12042605 |
| Molecular Formula | C23H17Cl2FN2O3S |
| Molecular Weight | 491.37 g/mol |
| Exact Mass | 490.03 |
| IUPAC Name | (2S)-3-[4-[(2,6-dichlorobenzoyl)amino]phenyl]-2-[(2-fluorobenzenecarbothioyl)amino]propanoic acid |
| SMILES | O=C(Nc1ccc(C[C@H](NC(=S)c2ccccc2F)C(=O)O)cc1)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C23H17Cl2FN2O3S/c24-16-5-3-6-17(25)20(16)21(29)27-14-10-8-13(9-11-14)12-19(23(30)31)28-22(32)15-4-1-2-7-18(15)26/h1-11,19H,12H2,(H,27,29)(H,28,32)(H,30,31)/t19-/m0/s1 |
| InChIKey | AJUHUHJLYMUVLK-IBGZPJMESA-N |
| XLogP | 5.35 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.37 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|