C26H20Cl2N2O6 — CID 139966656
4-[(E)-3-[[(1S)-1-carboxy-2-[4-[(2,6-dichlorobenzoyl)amino]phenyl]ethyl]amino]-3-oxoprop-1-enyl]benzoic acid (PubChem CID 139966656) has the molecular formula C26H20Cl2N2O6 and a molecular weight of 527.36 g/mol. Its IUPAC name is 4-[(E)-3-[[(1S)-1-carboxy-2-[4-[(2,6-dichlorobenzoyl)amino]phenyl]ethyl]amino]-3-oxoprop-1-enyl]benzoic acid.
| Compound Name | 4-[(E)-3-[[(1S)-1-carboxy-2-[4-[(2,6-dichlorobenzoyl)amino]phenyl]ethyl]amino]-3-oxoprop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 139966656 |
| Molecular Formula | C26H20Cl2N2O6 |
| Molecular Weight | 527.36 g/mol |
| Exact Mass | 526.07 |
| IUPAC Name | 4-[(E)-3-[[(1S)-1-carboxy-2-[4-[(2,6-dichlorobenzoyl)amino]phenyl]ethyl]amino]-3-oxoprop-1-enyl]benzoic acid |
| SMILES | O=C(/C=C/c1ccc(C(=O)O)cc1)N[C@@H](Cc1ccc(NC(=O)c2c(Cl)cccc2Cl)cc1)C(=O)O |
| InChI | InChI=1S/C26H20Cl2N2O6/c27-19-2-1-3-20(28)23(19)24(32)29-18-11-6-16(7-12-18)14-21(26(35)36)30-22(31)13-8-15-4-9-17(10-5-15)25(33)34/h1-13,21H,14H2,(H,29,32)(H,30,31)(H,33,34)(H,35,36)/b13-8+/t21-/m0/s1 |
| InChIKey | JCZOEINMANTZHI-LNYGYFNRSA-N |
| XLogP | 4.77 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.36 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|