C26H24Cl2N2O3S — CID 12042599
(2S)-3-[4-[(2,6-dichlorobenzoyl)amino]phenyl]-2-[(2-ethyl-6-methylbenzenecarbothioyl)amino]propanoic acid (PubChem CID 12042599) has the molecular formula C26H24Cl2N2O3S and a molecular weight of 515.46 g/mol. Its IUPAC name is (2S)-3-[4-[(2,6-dichlorobenzoyl)amino]phenyl]-2-[(2-ethyl-6-methylbenzenecarbothioyl)amino]propanoic acid.
| Compound Name | (2S)-3-[4-[(2,6-dichlorobenzoyl)amino]phenyl]-2-[(2-ethyl-6-methylbenzenecarbothioyl)amino]propanoic acid |
|---|---|
| PubChem CID | 12042599 |
| Molecular Formula | C26H24Cl2N2O3S |
| Molecular Weight | 515.46 g/mol |
| Exact Mass | 514.09 |
| IUPAC Name | (2S)-3-[4-[(2,6-dichlorobenzoyl)amino]phenyl]-2-[(2-ethyl-6-methylbenzenecarbothioyl)amino]propanoic acid |
| SMILES | CCc1cccc(C)c1C(=S)N[C@@H](Cc1ccc(NC(=O)c2c(Cl)cccc2Cl)cc1)C(=O)O |
| InChI | InChI=1S/C26H24Cl2N2O3S/c1-3-17-7-4-6-15(2)22(17)25(34)30-21(26(32)33)14-16-10-12-18(13-11-16)29-24(31)23-19(27)8-5-9-20(23)28/h4-13,21H,3,14H2,1-2H3,(H,29,31)(H,30,34)(H,32,33)/t21-/m0/s1 |
| InChIKey | ONRPMVRYZWRYMV-NRFANRHFSA-N |
| XLogP | 6.08 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.46 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|