C16H15FN2O2S — CID 142012676
3-(4-aminophenyl)-2-[(2-fluorobenzenecarbothioyl)amino]propanoic acid (PubChem CID 142012676) has the molecular formula C16H15FN2O2S and a molecular weight of 318.37 g/mol. Its IUPAC name is 3-(4-aminophenyl)-2-[(2-fluorobenzenecarbothioyl)amino]propanoic acid.
| Compound Name | 3-(4-aminophenyl)-2-[(2-fluorobenzenecarbothioyl)amino]propanoic acid |
|---|---|
| PubChem CID | 142012676 |
| Molecular Formula | C16H15FN2O2S |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 3-(4-aminophenyl)-2-[(2-fluorobenzenecarbothioyl)amino]propanoic acid |
| SMILES | Nc1ccc(CC(NC(=S)c2ccccc2F)C(=O)O)cc1 |
| InChI | InChI=1S/C16H15FN2O2S/c17-13-4-2-1-3-12(13)15(22)19-14(16(20)21)9-10-5-7-11(18)8-6-10/h1-8,14H,9,18H2,(H,19,22)(H,20,21) |
| InChIKey | RMVYAQUMAKSMHA-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|