C21H29FN2O3 — CID 160990970
CID 160990970 (PubChem CID 160990970) has the molecular formula C21H29FN2O3 and a molecular weight of 378.48 g/mol.
| Compound Name | CID 160990970 |
|---|---|
| PubChem CID | 160990970 |
| Molecular Formula | C21H29FN2O3 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | — |
| SMILES | C.O=C(O)CC1(Cc2ccc(OCCCNc3ccccn3)cc2)CC1.[3H]F |
| InChI | InChI=1S/C20H24N2O3.CH4.FH/c23-19(24)15-20(9-10-20)14-16-5-7-17(8-6-16)25-13-3-12-22-18-4-1-2-11-21-18;;/h1-2,4-8,11H,3,9-10,12-15H2,(H,21,22)(H,23,24);1H4;1H/i/hT |
| InChIKey | TUPQAIPRBIEQOU-MNYXATJNSA-N |
| XLogP | 4.55 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|