C24H25F2N3O5S — CID 11489005
2,2-difluoro-3-phenyl-3-[[3-[4-(pyridin-2-ylamino)butoxy]phenyl]sulfonylamino]propanoic acid (PubChem CID 11489005) has the molecular formula C24H25F2N3O5S and a molecular weight of 505.54 g/mol. Its IUPAC name is 2,2-difluoro-3-phenyl-3-[[3-[4-(pyridin-2-ylamino)butoxy]phenyl]sulfonylamino]propanoic acid.
| Compound Name | 2,2-difluoro-3-phenyl-3-[[3-[4-(pyridin-2-ylamino)butoxy]phenyl]sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 11489005 |
| Molecular Formula | C24H25F2N3O5S |
| Molecular Weight | 505.54 g/mol |
| Exact Mass | 505.15 |
| IUPAC Name | 2,2-difluoro-3-phenyl-3-[[3-[4-(pyridin-2-ylamino)butoxy]phenyl]sulfonylamino]propanoic acid |
| SMILES | O=C(O)C(F)(F)C(NS(=O)(=O)c1cccc(OCCCCNc2ccccn2)c1)c1ccccc1 |
| InChI | InChI=1S/C24H25F2N3O5S/c25-24(26,23(30)31)22(18-9-2-1-3-10-18)29-35(32,33)20-12-8-11-19(17-20)34-16-7-6-15-28-21-13-4-5-14-27-21/h1-5,8-14,17,22,29H,6-7,15-16H2,(H,27,28)(H,30,31) |
| InChIKey | MUXMURWZBXZFJQ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 117.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.54 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|