C25H23F3N2O4 — CID 87797398
[2-[2-[[3-[3-(pyridin-2-ylamino)propoxy]phenyl]methyl]phenyl]acetyl] 2,2,2-trifluoroacetate (PubChem CID 87797398) has the molecular formula C25H23F3N2O4 and a molecular weight of 472.46 g/mol. Its IUPAC name is [2-[2-[[3-[3-(pyridin-2-ylamino)propoxy]phenyl]methyl]phenyl]acetyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-[2-[[3-[3-(pyridin-2-ylamino)propoxy]phenyl]methyl]phenyl]acetyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87797398 |
| Molecular Formula | C25H23F3N2O4 |
| Molecular Weight | 472.46 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | [2-[2-[[3-[3-(pyridin-2-ylamino)propoxy]phenyl]methyl]phenyl]acetyl] 2,2,2-trifluoroacetate |
| SMILES | O=C(Cc1ccccc1Cc1cccc(OCCCNc2ccccn2)c1)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C25H23F3N2O4/c26-25(27,28)24(32)34-23(31)17-20-9-2-1-8-19(20)15-18-7-5-10-21(16-18)33-14-6-13-30-22-11-3-4-12-29-22/h1-5,7-12,16H,6,13-15,17H2,(H,29,30) |
| InChIKey | SJNSPKOZDLRJHM-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.46 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|