C25H30F3NO4 — CID 87179892
(2,2,2-trifluoroacetyl) 3-[3-[3-(5-phenylpentoxy)phenyl]propylamino]propanoate (PubChem CID 87179892) has the molecular formula C25H30F3NO4 and a molecular weight of 465.51 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 3-[3-[3-(5-phenylpentoxy)phenyl]propylamino]propanoate.
| Compound Name | (2,2,2-trifluoroacetyl) 3-[3-[3-(5-phenylpentoxy)phenyl]propylamino]propanoate |
|---|---|
| PubChem CID | 87179892 |
| Molecular Formula | C25H30F3NO4 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 3-[3-[3-(5-phenylpentoxy)phenyl]propylamino]propanoate |
| SMILES | O=C(CCNCCCc1cccc(OCCCCCc2ccccc2)c1)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C25H30F3NO4/c26-25(27,28)24(31)33-23(30)15-17-29-16-8-13-21-12-7-14-22(19-21)32-18-6-2-5-11-20-9-3-1-4-10-20/h1,3-4,7,9-10,12,14,19,29H,2,5-6,8,11,13,15-18H2 |
| InChIKey | JHLPJEFAINBQOM-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|