C22H32F3NO4 — CID 87180101
(2,2,2-trifluoroacetyl) 3-[2-(3-nonoxyphenyl)ethylamino]propanoate (PubChem CID 87180101) has the molecular formula C22H32F3NO4 and a molecular weight of 431.50 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 3-[2-(3-nonoxyphenyl)ethylamino]propanoate.
| Compound Name | (2,2,2-trifluoroacetyl) 3-[2-(3-nonoxyphenyl)ethylamino]propanoate |
|---|---|
| PubChem CID | 87180101 |
| Molecular Formula | C22H32F3NO4 |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 3-[2-(3-nonoxyphenyl)ethylamino]propanoate |
| SMILES | CCCCCCCCCOc1cccc(CCNCCC(=O)OC(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C22H32F3NO4/c1-2-3-4-5-6-7-8-16-29-19-11-9-10-18(17-19)12-14-26-15-13-20(27)30-21(28)22(23,24)25/h9-11,17,26H,2-8,12-16H2,1H3 |
| InChIKey | VKPWKPNJFGHKNU-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|