C23H26F3NO4 — CID 87180294
(2,2,2-trifluoroacetyl) 3-[3-[4-[2-(4-methylphenyl)ethoxy]phenyl]propylamino]propanoate (PubChem CID 87180294) has the molecular formula C23H26F3NO4 and a molecular weight of 437.46 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 3-[3-[4-[2-(4-methylphenyl)ethoxy]phenyl]propylamino]propanoate.
| Compound Name | (2,2,2-trifluoroacetyl) 3-[3-[4-[2-(4-methylphenyl)ethoxy]phenyl]propylamino]propanoate |
|---|---|
| PubChem CID | 87180294 |
| Molecular Formula | C23H26F3NO4 |
| Molecular Weight | 437.46 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 3-[3-[4-[2-(4-methylphenyl)ethoxy]phenyl]propylamino]propanoate |
| SMILES | Cc1ccc(CCOc2ccc(CCCNCCC(=O)OC(=O)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C23H26F3NO4/c1-17-4-6-19(7-5-17)13-16-30-20-10-8-18(9-11-20)3-2-14-27-15-12-21(28)31-22(29)23(24,25)26/h4-11,27H,2-3,12-16H2,1H3 |
| InChIKey | IKKWOJKLKPGVTN-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|