C21H22F3NO4 — CID 91473417
(2,2,2-trifluoroacetyl) (2S)-2-[2-[3-(2-phenylethoxy)phenyl]ethylamino]propanoate (PubChem CID 91473417) has the molecular formula C21H22F3NO4 and a molecular weight of 409.40 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) (2S)-2-[2-[3-(2-phenylethoxy)phenyl]ethylamino]propanoate.
| Compound Name | (2,2,2-trifluoroacetyl) (2S)-2-[2-[3-(2-phenylethoxy)phenyl]ethylamino]propanoate |
|---|---|
| PubChem CID | 91473417 |
| Molecular Formula | C21H22F3NO4 |
| Molecular Weight | 409.40 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | (2,2,2-trifluoroacetyl) (2S)-2-[2-[3-(2-phenylethoxy)phenyl]ethylamino]propanoate |
| SMILES | C[C@H](NCCc1cccc(OCCc2ccccc2)c1)C(=O)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C21H22F3NO4/c1-15(19(26)29-20(27)21(22,23)24)25-12-10-17-8-5-9-18(14-17)28-13-11-16-6-3-2-4-7-16/h2-9,14-15,25H,10-13H2,1H3/t15-/m0/s1 |
| InChIKey | NFOMYWWTBPWTAO-HNNXBMFYSA-N |
| XLogP | 3.46 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.40 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|