C36H38ClF3N2O3 — CID 69254334
(2S)-2-[2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]ethylamino]propanoic acid (PubChem CID 69254334) has the molecular formula C36H38ClF3N2O3 and a molecular weight of 639.16 g/mol. Its IUPAC name is (2S)-2-[2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]ethylamino]propanoic acid.
| Compound Name | (2S)-2-[2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]ethylamino]propanoic acid |
|---|---|
| PubChem CID | 69254334 |
| Molecular Formula | C36H38ClF3N2O3 |
| Molecular Weight | 639.16 g/mol |
| Exact Mass | 638.25 |
| IUPAC Name | (2S)-2-[2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]ethylamino]propanoic acid |
| SMILES | C[C@H](NCCc1cccc(OCCCN(Cc2cccc(C(F)(F)F)c2Cl)CC(c2ccccc2)c2ccccc2)c1)C(=O)O |
| InChI | InChI=1S/C36H38ClF3N2O3/c1-26(35(43)44)41-20-19-27-11-8-17-31(23-27)45-22-10-21-42(24-30-16-9-18-33(34(30)37)36(38,39)40)25-32(28-12-4-2-5-13-28)29-14-6-3-7-15-29/h2-9,11-18,23,26,32,41H,10,19-22,24-25H2,1H3,(H,43,44)/t26-/m0/s1 |
| InChIKey | JGCURACYVHCTSA-SANMLTNESA-N |
| XLogP | 8.07 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.16 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|