C33H31ClF3NO2 — CID 86598296
2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]acetaldehyde (PubChem CID 86598296) has the molecular formula C33H31ClF3NO2 and a molecular weight of 566.06 g/mol. Its IUPAC name is 2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]acetaldehyde.
| Compound Name | 2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]acetaldehyde |
|---|---|
| PubChem CID | 86598296 |
| Molecular Formula | C33H31ClF3NO2 |
| Molecular Weight | 566.06 g/mol |
| Exact Mass | 565.20 |
| IUPAC Name | 2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]acetaldehyde |
| SMILES | O=CCc1cccc(OCCCN(Cc2cccc(C(F)(F)F)c2Cl)CC(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C33H31ClF3NO2/c34-32-28(15-8-17-31(32)33(35,36)37)23-38(19-9-21-40-29-16-7-10-25(22-29)18-20-39)24-30(26-11-3-1-4-12-26)27-13-5-2-6-14-27/h1-8,10-17,20,22,30H,9,18-19,21,23-24H2 |
| InChIKey | RAKJOOLXAIAXEA-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.06 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|