C34H29ClF9NO2 — CID 118224526
2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 118224526) has the molecular formula C34H29ClF9NO2 and a molecular weight of 690.05 g/mol. Its IUPAC name is 2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 118224526 |
| Molecular Formula | C34H29ClF9NO2 |
| Molecular Weight | 690.05 g/mol |
| Exact Mass | 689.17 |
| IUPAC Name | 2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | OC(c1cccc(OCCCN(Cc2cccc(C(F)(F)F)c2Cl)CC(c2ccccc2)c2ccccc2)c1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C34H29ClF9NO2/c35-30-25(14-7-17-29(30)32(36,37)38)21-45(22-28(23-10-3-1-4-11-23)24-12-5-2-6-13-24)18-9-19-47-27-16-8-15-26(20-27)31(46,33(39,40)41)34(42,43)44/h1-8,10-17,20,28,46H,9,18-19,21-22H2 |
| InChIKey | AMFVOIGGTYRARJ-UHFFFAOYSA-N |
| XLogP | 9.77 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.05 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|