C32H28ClF3N2O — CID 10239707
3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]benzonitrile (PubChem CID 10239707) has the molecular formula C32H28ClF3N2O and a molecular weight of 549.04 g/mol. Its IUPAC name is 3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]benzonitrile.
| Compound Name | 3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]benzonitrile |
|---|---|
| PubChem CID | 10239707 |
| Molecular Formula | C32H28ClF3N2O |
| Molecular Weight | 549.04 g/mol |
| Exact Mass | 548.18 |
| IUPAC Name | 3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]benzonitrile |
| SMILES | N#Cc1cccc(OCCCN(Cc2cccc(C(F)(F)F)c2Cl)CC(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C32H28ClF3N2O/c33-31-27(15-8-17-30(31)32(34,35)36)22-38(18-9-19-39-28-16-7-10-24(20-28)21-37)23-29(25-11-3-1-4-12-25)26-13-5-2-6-14-26/h1-8,10-17,20,29H,9,18-19,22-23H2 |
| InChIKey | HEKWCHYMSHJKGY-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.04 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|