C32H31ClF3NO2 — CID 59701399
[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]methanol (PubChem CID 59701399) has the molecular formula C32H31ClF3NO2 and a molecular weight of 554.05 g/mol. Its IUPAC name is [3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]methanol.
| Compound Name | [3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]methanol |
|---|---|
| PubChem CID | 59701399 |
| Molecular Formula | C32H31ClF3NO2 |
| Molecular Weight | 554.05 g/mol |
| Exact Mass | 553.20 |
| IUPAC Name | [3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]methanol |
| SMILES | OCc1cccc(OCCCN(Cc2cccc(C(F)(F)F)c2Cl)CC(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C32H31ClF3NO2/c33-31-27(15-8-17-30(31)32(34,35)36)21-37(18-9-19-39-28-16-7-10-24(20-28)23-38)22-29(25-11-3-1-4-12-25)26-13-5-2-6-14-26/h1-8,10-17,20,29,38H,9,18-19,21-23H2 |
| InChIKey | UPURPZPDCBCILK-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.05 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|