C32H31ClF3NO4S — CID 126668258
5-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]-2-(hydroxymethyl)benzenesulfinic acid (PubChem CID 126668258) has the molecular formula C32H31ClF3NO4S and a molecular weight of 618.12 g/mol. Its IUPAC name is 5-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]-2-(hydroxymethyl)benzenesulfinic acid.
| Compound Name | 5-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]-2-(hydroxymethyl)benzenesulfinic acid |
|---|---|
| PubChem CID | 126668258 |
| Molecular Formula | C32H31ClF3NO4S |
| Molecular Weight | 618.12 g/mol |
| Exact Mass | 617.16 |
| IUPAC Name | 5-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]-2-(hydroxymethyl)benzenesulfinic acid |
| SMILES | O=S(O)c1cc(OCCCN(Cc2cccc(C(F)(F)F)c2Cl)CC(c2ccccc2)c2ccccc2)ccc1CO |
| InChI | InChI=1S/C32H31ClF3NO4S/c33-31-25(13-7-14-29(31)32(34,35)36)20-37(17-8-18-41-27-16-15-26(22-38)30(19-27)42(39)40)21-28(23-9-3-1-4-10-23)24-11-5-2-6-12-24/h1-7,9-16,19,28,38H,8,17-18,20-22H2,(H,39,40) |
| InChIKey | DOXZKYMBRLHYIG-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.12 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|