C34H34ClF4NO3S — CID 144886276
1-[4-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]-2-fluoro-6-methylsulfinylphenyl]ethanol (PubChem CID 144886276) has the molecular formula C34H34ClF4NO3S and a molecular weight of 648.16 g/mol. Its IUPAC name is 1-[4-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]-2-fluoro-6-methylsulfinylphenyl]ethanol.
| Compound Name | 1-[4-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]-2-fluoro-6-methylsulfinylphenyl]ethanol |
|---|---|
| PubChem CID | 144886276 |
| Molecular Formula | C34H34ClF4NO3S |
| Molecular Weight | 648.16 g/mol |
| Exact Mass | 647.19 |
| IUPAC Name | 1-[4-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]-2-fluoro-6-methylsulfinylphenyl]ethanol |
| SMILES | CC(O)c1c(F)cc(OCCCN(Cc2cccc(C(F)(F)F)c2Cl)CC(c2ccccc2)c2ccccc2)cc1S(C)=O |
| InChI | InChI=1S/C34H34ClF4NO3S/c1-23(41)32-30(36)19-27(20-31(32)44(2)42)43-18-10-17-40(21-26-15-9-16-29(33(26)35)34(37,38)39)22-28(24-11-5-3-6-12-24)25-13-7-4-8-14-25/h3-9,11-16,19-20,23,28,41H,10,17-18,21-22H2,1-2H3 |
| InChIKey | DABAGDWOWLWSCJ-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.16 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|