C33H32ClF4NO6S — CID 144886263
[4-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]-2-fluoro-6-methylsulfonylphenyl]methanetriol (PubChem CID 144886263) has the molecular formula C33H32ClF4NO6S and a molecular weight of 682.13 g/mol. Its IUPAC name is [4-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]-2-fluoro-6-methylsulfonylphenyl]methanetriol.
| Compound Name | [4-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]-2-fluoro-6-methylsulfonylphenyl]methanetriol |
|---|---|
| PubChem CID | 144886263 |
| Molecular Formula | C33H32ClF4NO6S |
| Molecular Weight | 682.13 g/mol |
| Exact Mass | 681.16 |
| IUPAC Name | [4-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]-2-fluoro-6-methylsulfonylphenyl]methanetriol |
| SMILES | CS(=O)(=O)c1cc(OCCCN(Cc2cccc(C(F)(F)F)c2Cl)CC(c2ccccc2)c2ccccc2)cc(F)c1C(O)(O)O |
| InChI | InChI=1S/C33H32ClF4NO6S/c1-46(43,44)29-19-25(18-28(35)30(29)33(40,41)42)45-17-9-16-39(20-24-14-8-15-27(31(24)34)32(36,37)38)21-26(22-10-4-2-5-11-22)23-12-6-3-7-13-23/h2-8,10-15,18-19,26,40-42H,9,16-17,20-21H2,1H3 |
| InChIKey | AJHNPHWRTYXUEF-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.13 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|