C27H29ClF3NO4S — CID 126646429
1-[4-[3-[benzyl-[[2-chloro-3-(trifluoromethyl)phenyl]methyl]amino]propoxy]-2-methylsulfonylphenyl]ethanol (PubChem CID 126646429) has the molecular formula C27H29ClF3NO4S and a molecular weight of 556.05 g/mol. Its IUPAC name is 1-[4-[3-[benzyl-[[2-chloro-3-(trifluoromethyl)phenyl]methyl]amino]propoxy]-2-methylsulfonylphenyl]ethanol.
| Compound Name | 1-[4-[3-[benzyl-[[2-chloro-3-(trifluoromethyl)phenyl]methyl]amino]propoxy]-2-methylsulfonylphenyl]ethanol |
|---|---|
| PubChem CID | 126646429 |
| Molecular Formula | C27H29ClF3NO4S |
| Molecular Weight | 556.05 g/mol |
| Exact Mass | 555.15 |
| IUPAC Name | 1-[4-[3-[benzyl-[[2-chloro-3-(trifluoromethyl)phenyl]methyl]amino]propoxy]-2-methylsulfonylphenyl]ethanol |
| SMILES | CC(O)c1ccc(OCCCN(Cc2ccccc2)Cc2cccc(C(F)(F)F)c2Cl)cc1S(C)(=O)=O |
| InChI | InChI=1S/C27H29ClF3NO4S/c1-19(33)23-13-12-22(16-25(23)37(2,34)35)36-15-7-14-32(17-20-8-4-3-5-9-20)18-21-10-6-11-24(26(21)28)27(29,30)31/h3-6,8-13,16,19,33H,7,14-15,17-18H2,1-2H3 |
| InChIKey | NXDKVRVFIHYFOS-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.05 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|